C25H40O3 — CID 85250956
1-(3,5-dihydroxyphenyl)nonadec-10-en-2-one (PubChem CID 85250956) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is 1-(3,5-dihydroxyphenyl)nonadec-10-en-2-one.
| Compound Name | 1-(3,5-dihydroxyphenyl)nonadec-10-en-2-one |
|---|---|
| PubChem CID | 85250956 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | 1-(3,5-dihydroxyphenyl)nonadec-10-en-2-one |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)Cc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C25H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(26)18-22-19-24(27)21-25(28)20-22/h9-10,19-21,27-28H,2-8,11-18H2,1H3 |
| InChIKey | KRPARHHCQTYXKH-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|