C28H46O3 — CID 85190896
1-(3,4-dihydroxyphenyl)docos-13-en-5-one (PubChem CID 85190896) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)docos-13-en-5-one.
| Compound Name | 1-(3,4-dihydroxyphenyl)docos-13-en-5-one |
|---|---|
| PubChem CID | 85190896 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)docos-13-en-5-one |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)CCCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C28H46O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-26(29)21-18-17-19-25-22-23-27(30)28(31)24-25/h9-10,22-24,30-31H,2-8,11-21H2,1H3 |
| InChIKey | RLQBAGQABRADHE-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|