C22H32 — CID 142383088
1-methyl-3-[(8E,11E)-pentadeca-8,11,14-trienyl]benzene (PubChem CID 142383088) has the molecular formula C22H32 and a molecular weight of 296.50 g/mol. Its IUPAC name is 1-methyl-3-[(8E,11E)-pentadeca-8,11,14-trienyl]benzene.
| Compound Name | 1-methyl-3-[(8E,11E)-pentadeca-8,11,14-trienyl]benzene |
|---|---|
| PubChem CID | 142383088 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 1-methyl-3-[(8E,11E)-pentadeca-8,11,14-trienyl]benzene |
| SMILES | C=CC/C=C/C/C=C/CCCCCCCc1cccc(C)c1 |
| InChI | InChI=1S/C22H32/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-22-19-16-17-21(2)20-22/h3,5-6,8-9,16-17,19-20H,1,4,7,10-15,18H2,2H3/b6-5+,9-8+ |
| InChIKey | PCVVUDGEERUFTP-HHWLVVFRSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|