About ethane;1-methyl-3-pentylbenzene
ethane;1-methyl-3-pentylbenzene (PubChem CID 143267779) has the molecular formula C14H24
and a molecular weight of 192.35 g/mol. Its IUPAC name is ethane;1-methyl-3-pentylbenzene.
Molecular Properties
| Compound Name | ethane;1-methyl-3-pentylbenzene |
| PubChem CID | 143267779 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | ethane;1-methyl-3-pentylbenzene |
| SMILES | CC.CCCCCc1cccc(C)c1 |
| InChI | InChI=1S/C12H18.C2H6/c1-3-4-5-8-12-9-6-7-11(2)10-12;1-2/h6-7,9-10H,3-5,8H2,1-2H3;1-2H3 |
| InChIKey | LXFLEQBGDCHDON-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methyl-3-pentylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-3-pentylbenzene?
The IUPAC name of ethane;1-methyl-3-pentylbenzene (CID 143267779) is ethane;1-methyl-3-pentylbenzene.
What is the SMILES notation for ethane;1-methyl-3-pentylbenzene?
The canonical SMILES for ethane;1-methyl-3-pentylbenzene is CC.CCCCCc1cccc(C)c1.
What is the InChIKey of ethane;1-methyl-3-pentylbenzene?
The InChIKey is LXFLEQBGDCHDON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C2H6/c1-3-4-5-8-12-9-6-7-11(2)10-12;1-2/h6-7,9-10H,3-5,8H2,1-2H3;1-2H3.
What are the key properties of ethane;1-methyl-3-pentylbenzene?
ethane;1-methyl-3-pentylbenzene has a molecular weight of 192.35 g/mol, XLogP of 4.75, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-3-pentylbenzene is sourced from PubChem (CID 143267779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).