About 1-butyl-3-methylbenzene;ethane;propane
1-butyl-3-methylbenzene;ethane;propane (PubChem CID 142068173) has the molecular formula C16H30
and a molecular weight of 222.42 g/mol. Its IUPAC name is 1-butyl-3-methylbenzene;ethane;propane.
Molecular Properties
| Compound Name | 1-butyl-3-methylbenzene;ethane;propane |
| PubChem CID | 142068173 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 1-butyl-3-methylbenzene;ethane;propane |
| SMILES | CC.CCC.CCCCc1cccc(C)c1 |
| InChI | InChI=1S/C11H16.C3H8.C2H6/c1-3-4-7-11-8-5-6-10(2)9-11;1-3-2;1-2/h5-6,8-9H,3-4,7H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | RXEUKXQVLFLPSI-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-butyl-3-methylbenzene;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylbenzene;ethane;propane?
The IUPAC name of 1-butyl-3-methylbenzene;ethane;propane (CID 142068173) is 1-butyl-3-methylbenzene;ethane;propane.
What is the SMILES notation for 1-butyl-3-methylbenzene;ethane;propane?
The canonical SMILES for 1-butyl-3-methylbenzene;ethane;propane is CC.CCC.CCCCc1cccc(C)c1.
What is the InChIKey of 1-butyl-3-methylbenzene;ethane;propane?
The InChIKey is RXEUKXQVLFLPSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.C3H8.C2H6/c1-3-4-7-11-8-5-6-10(2)9-11;1-3-2;1-2/h5-6,8-9H,3-4,7H2,1-2H3;3H2,1-2H3;1-2H3.
What are the key properties of 1-butyl-3-methylbenzene;ethane;propane?
1-butyl-3-methylbenzene;ethane;propane has a molecular weight of 222.42 g/mol, XLogP of 5.78, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylbenzene;ethane;propane is sourced from PubChem (CID 142068173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).