C27H47NO3 — CID 5387960
2-[(dimethylamino)methyl]-3-[(Z)-heptadec-10-enyl]-5-methoxybenzene-1,4-diol (PubChem CID 5387960) has the molecular formula C27H47NO3 and a molecular weight of 433.68 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-3-[(Z)-heptadec-10-enyl]-5-methoxybenzene-1,4-diol.
| Compound Name | 2-[(dimethylamino)methyl]-3-[(Z)-heptadec-10-enyl]-5-methoxybenzene-1,4-diol |
|---|---|
| PubChem CID | 5387960 |
| Molecular Formula | C27H47NO3 |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.36 |
| IUPAC Name | 2-[(dimethylamino)methyl]-3-[(Z)-heptadec-10-enyl]-5-methoxybenzene-1,4-diol |
| SMILES | CCCCCC/C=C\CCCCCCCCCc1c(O)c(OC)cc(O)c1CN(C)C |
| InChI | InChI=1S/C27H47NO3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-24(22-28(2)3)25(29)21-26(31-4)27(23)30/h10-11,21,29-30H,5-9,12-20,22H2,1-4H3/b11-10- |
| InChIKey | CNGOBHQDIPZURE-KHPPLWFESA-N |
| XLogP | 7.36 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|