C20H32O4 — CID 53349042
(E)-10-(2,3,4-trimethoxy-6-methylphenyl)dec-8-en-1-ol (PubChem CID 53349042) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (E)-10-(2,3,4-trimethoxy-6-methylphenyl)dec-8-en-1-ol.
| Compound Name | (E)-10-(2,3,4-trimethoxy-6-methylphenyl)dec-8-en-1-ol |
|---|---|
| PubChem CID | 53349042 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (E)-10-(2,3,4-trimethoxy-6-methylphenyl)dec-8-en-1-ol |
| SMILES | COc1cc(C)c(C/C=C/CCCCCCCO)c(OC)c1OC |
| InChI | InChI=1S/C20H32O4/c1-16-15-18(22-2)20(24-4)19(23-3)17(16)13-11-9-7-5-6-8-10-12-14-21/h9,11,15,21H,5-8,10,12-14H2,1-4H3/b11-9+ |
| InChIKey | UBUHVMOHVJWYOP-PKNBQFBNSA-N |
| XLogP | 4.45 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|