C9H9F3O4 — CID 163283549
3,5-dimethoxy-2-(trifluoromethyl)benzene-1,4-diol (PubChem CID 163283549) has the molecular formula C9H9F3O4 and a molecular weight of 238.16 g/mol. Its IUPAC name is 3,5-dimethoxy-2-(trifluoromethyl)benzene-1,4-diol.
| Compound Name | 3,5-dimethoxy-2-(trifluoromethyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 163283549 |
| Molecular Formula | C9H9F3O4 |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 3,5-dimethoxy-2-(trifluoromethyl)benzene-1,4-diol |
| SMILES | COc1cc(O)c(C(F)(F)F)c(OC)c1O |
| InChI | InChI=1S/C9H9F3O4/c1-15-5-3-4(13)6(9(10,11)12)8(16-2)7(5)14/h3,13-14H,1-2H3 |
| InChIKey | ZGDIWPXNFXGXRZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|