C11H10F6O3 — CID 137442942
1,3,5-trimethoxy-2,4-bis(trifluoromethyl)benzene (PubChem CID 137442942) has the molecular formula C11H10F6O3 and a molecular weight of 304.19 g/mol. Its IUPAC name is 1,3,5-trimethoxy-2,4-bis(trifluoromethyl)benzene.
| Compound Name | 1,3,5-trimethoxy-2,4-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 137442942 |
| Molecular Formula | C11H10F6O3 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1,3,5-trimethoxy-2,4-bis(trifluoromethyl)benzene |
| SMILES | COc1cc(OC)c(C(F)(F)F)c(OC)c1C(F)(F)F |
| InChI | InChI=1S/C11H10F6O3/c1-18-5-4-6(19-2)8(11(15,16)17)9(20-3)7(5)10(12,13)14/h4H,1-3H3 |
| InChIKey | YOZQSLQXULHUJL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |