C11H14F2O3 — CID 116841570
2-(1,1-difluoroethyl)-1,3,5-trimethoxybenzene (PubChem CID 116841570) has the molecular formula C11H14F2O3 and a molecular weight of 232.23 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-1,3,5-trimethoxybenzene.
| Compound Name | 2-(1,1-difluoroethyl)-1,3,5-trimethoxybenzene |
|---|---|
| PubChem CID | 116841570 |
| Molecular Formula | C11H14F2O3 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-(1,1-difluoroethyl)-1,3,5-trimethoxybenzene |
| SMILES | COc1cc(OC)c(C(C)(F)F)c(OC)c1 |
| InChI | InChI=1S/C11H14F2O3/c1-11(12,13)10-8(15-3)5-7(14-2)6-9(10)16-4/h5-6H,1-4H3 |
| InChIKey | AJFQCEZFTPZUSX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |