C15H25O3P — CID 166753423
3-(2,4,6-trimethoxyphenyl)hexan-3-ylphosphane (PubChem CID 166753423) has the molecular formula C15H25O3P and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-(2,4,6-trimethoxyphenyl)hexan-3-ylphosphane.
| Compound Name | 3-(2,4,6-trimethoxyphenyl)hexan-3-ylphosphane |
|---|---|
| PubChem CID | 166753423 |
| Molecular Formula | C15H25O3P |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 3-(2,4,6-trimethoxyphenyl)hexan-3-ylphosphane |
| SMILES | CCCC(P)(CC)c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C15H25O3P/c1-6-8-15(19,7-2)14-12(17-4)9-11(16-3)10-13(14)18-5/h9-10H,6-8,19H2,1-5H3 |
| InChIKey | DPUZSJFUWBEFJA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|