C14H23O3P — CID 71040141
methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane (PubChem CID 71040141) has the molecular formula C14H23O3P and a molecular weight of 270.31 g/mol. Its IUPAC name is methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane.
| Compound Name | methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane |
|---|---|
| PubChem CID | 71040141 |
| Molecular Formula | C14H23O3P |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane |
| SMILES | CCC(C)(PC)c1cc(OC)cc(OC)c1OC |
| InChI | InChI=1S/C14H23O3P/c1-7-14(2,18-6)11-8-10(15-3)9-12(16-4)13(11)17-5/h8-9,18H,7H2,1-6H3 |
| InChIKey | XVMQNFMEUUVDJP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|