About methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane
methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane (PubChem CID 71040141) has the molecular formula C14H23O3P
and a molecular weight of 270.31 g/mol. Its IUPAC name is methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane.
Molecular Properties
| Compound Name | methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane |
| PubChem CID | 71040141 |
| Molecular Formula | C14H23O3P |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane |
| SMILES | CCC(C)(PC)c1cc(OC)cc(OC)c1OC |
| InChI | InChI=1S/C14H23O3P/c1-7-14(2,18-6)11-8-10(15-3)9-12(16-4)13(11)17-5/h8-9,18H,7H2,1-6H3 |
| InChIKey | XVMQNFMEUUVDJP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane?
The IUPAC name of methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane (CID 71040141) is methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane.
What is the SMILES notation for methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane?
The canonical SMILES for methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane is CCC(C)(PC)c1cc(OC)cc(OC)c1OC.
What is the InChIKey of methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane?
The InChIKey is XVMQNFMEUUVDJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23O3P/c1-7-14(2,18-6)11-8-10(15-3)9-12(16-4)13(11)17-5/h8-9,18H,7H2,1-6H3.
What are the key properties of methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane?
methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane has a molecular weight of 270.31 g/mol, XLogP of 3.65, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[2-(2,3,5-trimethoxyphenyl)butan-2-yl]phosphane is sourced from PubChem (CID 71040141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).