C14H20O5 — CID 116963092
methyl 2-methyl-2-(2,4,6-trimethoxyphenyl)propanoate (PubChem CID 116963092) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is methyl 2-methyl-2-(2,4,6-trimethoxyphenyl)propanoate.
| Compound Name | methyl 2-methyl-2-(2,4,6-trimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 116963092 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | methyl 2-methyl-2-(2,4,6-trimethoxyphenyl)propanoate |
| SMILES | COC(=O)C(C)(C)c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C14H20O5/c1-14(2,13(15)19-6)12-10(17-4)7-9(16-3)8-11(12)18-5/h7-8H,1-6H3 |
| InChIKey | LQXAYZBWIPZHBK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |