C13H16F2O5 — CID 28745556
4,4-difluoro-4-(2,4,6-trimethoxyphenyl)butanoic acid (PubChem CID 28745556) has the molecular formula C13H16F2O5 and a molecular weight of 290.26 g/mol. Its IUPAC name is 4,4-difluoro-4-(2,4,6-trimethoxyphenyl)butanoic acid.
| Compound Name | 4,4-difluoro-4-(2,4,6-trimethoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 28745556 |
| Molecular Formula | C13H16F2O5 |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 4,4-difluoro-4-(2,4,6-trimethoxyphenyl)butanoic acid |
| SMILES | COc1cc(OC)c(C(F)(F)CCC(=O)O)c(OC)c1 |
| InChI | InChI=1S/C13H16F2O5/c1-18-8-6-9(19-2)12(10(7-8)20-3)13(14,15)5-4-11(16)17/h6-7H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | GFWHSSNHZKAUGU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |