3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid

C21H23O8P — CID 175364202

IUPAC3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid
SMILESCOc1ccc(C(=O)P(CCC(=O)O)C(=O)c2ccc(OC)cc2OC)c(OC)c1
InChIInChI=1S/C21H23O8P/c1-26-13-5-7-15(17(11-13)28-3)20(24)30(10-9-19(22)23)21(25)16-8-6-14(27-2)12-18(16)29-4/h5-8,11-12H,9-10H2,1-4H3,(H,22,23)
InChIKeyCMDBHNDHSTYENN-UHFFFAOYSA-N
MW434.38 g/mol
LogP3.66
Rot. Bonds11

About 3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid

3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid (PubChem CID 175364202) has the molecular formula C21H23O8P and a molecular weight of 434.38 g/mol. Its IUPAC name is 3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid.

Molecular Properties

Compound Name3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid
PubChem CID175364202
Molecular FormulaC21H23O8P
Molecular Weight434.38 g/mol
Exact Mass434.11
IUPAC Name3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid
SMILESCOc1ccc(C(=O)P(CCC(=O)O)C(=O)c2ccc(OC)cc2OC)c(OC)c1
InChIInChI=1S/C21H23O8P/c1-26-13-5-7-15(17(11-13)28-3)20(24)30(10-9-19(22)23)21(25)16-8-6-14(27-2)12-18(16)29-4/h5-8,11-12H,9-10H2,1-4H3,(H,22,23)
InChIKeyCMDBHNDHSTYENN-UHFFFAOYSA-N
XLogP3.66
TPSA108.36 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds11
Heavy Atoms30
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500434.38
LogP ≤ 53.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid?
The IUPAC name of 3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid (CID 175364202) is 3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid.
What is the SMILES notation for 3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid?
The canonical SMILES for 3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid is COc1ccc(C(=O)P(CCC(=O)O)C(=O)c2ccc(OC)cc2OC)c(OC)c1.
What is the InChIKey of 3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid?
The InChIKey is CMDBHNDHSTYENN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23O8P/c1-26-13-5-7-15(17(11-13)28-3)20(24)30(10-9-19(22)23)21(25)16-8-6-14(27-2)12-18(16)29-4/h5-8,11-12H,9-10H2,1-4H3,(H,22,23).
What are the key properties of 3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid?
3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid has a molecular weight of 434.38 g/mol, XLogP of 3.66, 11 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bis(2,4-dimethoxybenzoyl)phosphanylpropanoic acid is sourced from PubChem (CID 175364202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).