C10H10O4 — CID 86181378
2-(2,4-dimethoxyphenyl)-2-hydroxyethenone (PubChem CID 86181378) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-2-hydroxyethenone.
| Compound Name | 2-(2,4-dimethoxyphenyl)-2-hydroxyethenone |
|---|---|
| PubChem CID | 86181378 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-2-hydroxyethenone |
| SMILES | COc1ccc(C(O)=C=O)c(OC)c1 |
| InChI | InChI=1S/C10H10O4/c1-13-7-3-4-8(9(12)6-11)10(5-7)14-2/h3-5,12H,1-2H3 |
| InChIKey | CPHQYRLXVDLVPT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|