C16H20O5 — CID 114391792
2-(2,4-dimethoxybenzoyl)-4-methylcyclopentane-1-carboxylic acid (PubChem CID 114391792) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-(2,4-dimethoxybenzoyl)-4-methylcyclopentane-1-carboxylic acid.
| Compound Name | 2-(2,4-dimethoxybenzoyl)-4-methylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 114391792 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(2,4-dimethoxybenzoyl)-4-methylcyclopentane-1-carboxylic acid |
| SMILES | COc1ccc(C(=O)C2CC(C)CC2C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C16H20O5/c1-9-6-12(13(7-9)16(18)19)15(17)11-5-4-10(20-2)8-14(11)21-3/h4-5,8-9,12-13H,6-7H2,1-3H3,(H,18,19) |
| InChIKey | BTYOIUAHGONQBQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |