C18H18O3 — CID 65406839
2,3-dihydro-1H-inden-2-yl-(2,4-dimethoxyphenyl)methanone (PubChem CID 65406839) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-yl-(2,4-dimethoxyphenyl)methanone.
| Compound Name | 2,3-dihydro-1H-inden-2-yl-(2,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 65406839 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-yl-(2,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)C2Cc3ccccc3C2)c(OC)c1 |
| InChI | InChI=1S/C18H18O3/c1-20-15-7-8-16(17(11-15)21-2)18(19)14-9-12-5-3-4-6-13(12)10-14/h3-8,11,14H,9-10H2,1-2H3 |
| InChIKey | QIGVNEXHQFJINW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |