C16H20O4 — CID 114391912
2-(2-methoxy-5-methylbenzoyl)-4-methylcyclopentane-1-carboxylic acid (PubChem CID 114391912) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 2-(2-methoxy-5-methylbenzoyl)-4-methylcyclopentane-1-carboxylic acid.
| Compound Name | 2-(2-methoxy-5-methylbenzoyl)-4-methylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 114391912 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2-(2-methoxy-5-methylbenzoyl)-4-methylcyclopentane-1-carboxylic acid |
| SMILES | COc1ccc(C)cc1C(=O)C1CC(C)CC1C(=O)O |
| InChI | InChI=1S/C16H20O4/c1-9-4-5-14(20-3)13(6-9)15(17)11-7-10(2)8-12(11)16(18)19/h4-6,10-12H,7-8H2,1-3H3,(H,18,19) |
| InChIKey | JSGKLFLZMVNSBV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |