2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid

C13H14O3 — CID 116918498

IUPAC2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid
SMILESCc1ccc(C(=O)C2CC2C(=O)O)c(C)c1
InChIInChI=1S/C13H14O3/c1-7-3-4-9(8(2)5-7)12(14)10-6-11(10)13(15)16/h3-5,10-11H,6H2,1-2H3,(H,15,16)
InChIKeyMWKXMSMYBSOGET-UHFFFAOYSA-N
MW218.25 g/mol
LogP2.21
Rot. Bonds3

About 2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid

2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid (PubChem CID 116918498) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid.

Molecular Properties

Compound Name2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid
PubChem CID116918498
Molecular FormulaC13H14O3
Molecular Weight218.25 g/mol
Exact Mass218.09
IUPAC Name2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid
SMILESCc1ccc(C(=O)C2CC2C(=O)O)c(C)c1
InChIInChI=1S/C13H14O3/c1-7-3-4-9(8(2)5-7)12(14)10-6-11(10)13(15)16/h3-5,10-11H,6H2,1-2H3,(H,15,16)
InChIKeyMWKXMSMYBSOGET-UHFFFAOYSA-N
XLogP2.21
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.25
LogP ≤ 52.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid?
The IUPAC name of 2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid (CID 116918498) is 2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for 2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid?
The canonical SMILES for 2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid is Cc1ccc(C(=O)C2CC2C(=O)O)c(C)c1.
What is the InChIKey of 2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid?
The InChIKey is MWKXMSMYBSOGET-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O3/c1-7-3-4-9(8(2)5-7)12(14)10-6-11(10)13(15)16/h3-5,10-11H,6H2,1-2H3,(H,15,16).
What are the key properties of 2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid?
2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid has a molecular weight of 218.25 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethylbenzoyl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 116918498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).