C14H18O3S2 — CID 115385666
(2,4-dimethoxyphenyl)-(3-methyl-1,4-dithian-2-yl)methanone (PubChem CID 115385666) has the molecular formula C14H18O3S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-(3-methyl-1,4-dithian-2-yl)methanone.
| Compound Name | (2,4-dimethoxyphenyl)-(3-methyl-1,4-dithian-2-yl)methanone |
|---|---|
| PubChem CID | 115385666 |
| Molecular Formula | C14H18O3S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | (2,4-dimethoxyphenyl)-(3-methyl-1,4-dithian-2-yl)methanone |
| SMILES | COc1ccc(C(=O)C2SCCSC2C)c(OC)c1 |
| InChI | InChI=1S/C14H18O3S2/c1-9-14(19-7-6-18-9)13(15)11-5-4-10(16-2)8-12(11)17-3/h4-5,8-9,14H,6-7H2,1-3H3 |
| InChIKey | GOCTYTOPXPPZSB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |