C13H16O3S2 — CID 79972621
(2,5-dimethoxyphenyl)-(1,4-dithian-2-yl)methanone (PubChem CID 79972621) has the molecular formula C13H16O3S2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)-(1,4-dithian-2-yl)methanone.
| Compound Name | (2,5-dimethoxyphenyl)-(1,4-dithian-2-yl)methanone |
|---|---|
| PubChem CID | 79972621 |
| Molecular Formula | C13H16O3S2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | (2,5-dimethoxyphenyl)-(1,4-dithian-2-yl)methanone |
| SMILES | COc1ccc(OC)c(C(=O)C2CSCCS2)c1 |
| InChI | InChI=1S/C13H16O3S2/c1-15-9-3-4-11(16-2)10(7-9)13(14)12-8-17-5-6-18-12/h3-4,7,12H,5-6,8H2,1-2H3 |
| InChIKey | ODTFNZQTLQLODJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |