C17H24O3 — CID 114975483
(2,5-dimethoxyphenyl)-(3,4-dimethylcyclohexyl)methanone (PubChem CID 114975483) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)-(3,4-dimethylcyclohexyl)methanone.
| Compound Name | (2,5-dimethoxyphenyl)-(3,4-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 114975483 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (2,5-dimethoxyphenyl)-(3,4-dimethylcyclohexyl)methanone |
| SMILES | COc1ccc(OC)c(C(=O)C2CCC(C)C(C)C2)c1 |
| InChI | InChI=1S/C17H24O3/c1-11-5-6-13(9-12(11)2)17(18)15-10-14(19-3)7-8-16(15)20-4/h7-8,10-13H,5-6,9H2,1-4H3 |
| InChIKey | HAHLHSGAORDNEN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |