C11H11NO2 — CID 82075391
2-(2,4-dimethoxyphenyl)prop-2-enenitrile (PubChem CID 82075391) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(2,4-dimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 82075391 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)prop-2-enenitrile |
| SMILES | C=C(C#N)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C11H11NO2/c1-8(7-12)10-5-4-9(13-2)6-11(10)14-3/h4-6H,1H2,2-3H3 |
| InChIKey | DXOXTHZFGXQIRC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|