C12H13NO2 — CID 82076703
(Z)-2-(2,5-dimethoxyphenyl)but-2-enenitrile (PubChem CID 82076703) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (Z)-2-(2,5-dimethoxyphenyl)but-2-enenitrile.
| Compound Name | (Z)-2-(2,5-dimethoxyphenyl)but-2-enenitrile |
|---|---|
| PubChem CID | 82076703 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (Z)-2-(2,5-dimethoxyphenyl)but-2-enenitrile |
| SMILES | C/C=C(\C#N)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C12H13NO2/c1-4-9(8-13)11-7-10(14-2)5-6-12(11)15-3/h4-7H,1-3H3/b9-4+ |
| InChIKey | LUPHZPPYAJSSIX-RUDMXATFSA-N |
| XLogP | 2.63 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|