C12H16O2 — CID 10035483
2-[(Z)-but-2-en-2-yl]-1,4-dimethoxybenzene (PubChem CID 10035483) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-[(Z)-but-2-en-2-yl]-1,4-dimethoxybenzene.
| Compound Name | 2-[(Z)-but-2-en-2-yl]-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 10035483 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-[(Z)-but-2-en-2-yl]-1,4-dimethoxybenzene |
| SMILES | C/C=C(/C)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C12H16O2/c1-5-9(2)11-8-10(13-3)6-7-12(11)14-4/h5-8H,1-4H3/b9-5- |
| InChIKey | RMGWUTNAJPJOKJ-UITAMQMPSA-N |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |