C17H26O2 — CID 143859267
2-[(E)-5-ethylhept-2-en-2-yl]-1,4-dimethoxybenzene (PubChem CID 143859267) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-[(E)-5-ethylhept-2-en-2-yl]-1,4-dimethoxybenzene.
| Compound Name | 2-[(E)-5-ethylhept-2-en-2-yl]-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 143859267 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2-[(E)-5-ethylhept-2-en-2-yl]-1,4-dimethoxybenzene |
| SMILES | CCC(CC)C/C=C(\C)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C17H26O2/c1-6-14(7-2)9-8-13(3)16-12-15(18-4)10-11-17(16)19-5/h8,10-12,14H,6-7,9H2,1-5H3/b13-8+ |
| InChIKey | DMWZRQBCHWPKAQ-MDWZMJQESA-N |
| XLogP | 4.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |