C14H19NO4 — CID 112510921
N-butan-2-yl-2-(2,5-dimethoxyphenyl)-2-oxoacetamide (PubChem CID 112510921) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-butan-2-yl-2-(2,5-dimethoxyphenyl)-2-oxoacetamide.
| Compound Name | N-butan-2-yl-2-(2,5-dimethoxyphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 112510921 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-butan-2-yl-2-(2,5-dimethoxyphenyl)-2-oxoacetamide |
| SMILES | CCC(C)NC(=O)C(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C14H19NO4/c1-5-9(2)15-14(17)13(16)11-8-10(18-3)6-7-12(11)19-4/h6-9H,5H2,1-4H3,(H,15,17) |
| InChIKey | ZBNPRXQOFOVNBG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|