C16H22O5 — CID 2360410
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-ethylbutanoate (PubChem CID 2360410) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-ethylbutanoate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-ethylbutanoate |
|---|---|
| PubChem CID | 2360410 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)OCC(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C16H22O5/c1-5-11(6-2)16(18)21-10-14(17)13-9-12(19-3)7-8-15(13)20-4/h7-9,11H,5-6,10H2,1-4H3 |
| InChIKey | ALZPTEGVJKNDMN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |