C15H22O5 — CID 115480661
1-(2,5-dimethoxyphenyl)-3,3-diethoxypropan-1-one (PubChem CID 115480661) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3,3-diethoxypropan-1-one.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3,3-diethoxypropan-1-one |
|---|---|
| PubChem CID | 115480661 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3,3-diethoxypropan-1-one |
| SMILES | CCOC(CC(=O)c1cc(OC)ccc1OC)OCC |
| InChI | InChI=1S/C15H22O5/c1-5-19-15(20-6-2)10-13(16)12-9-11(17-3)7-8-14(12)18-4/h7-9,15H,5-6,10H2,1-4H3 |
| InChIKey | YXMRKWFLOWTDCL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|