methyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate

C14H18O4 — CID 90051649

IUPACmethyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate
SMILESCOC(=O)C/C=C(/C)c1cc(OC)ccc1OC
InChIInChI=1S/C14H18O4/c1-10(5-8-14(15)18-4)12-9-11(16-2)6-7-13(12)17-3/h5-7,9H,8H2,1-4H3/b10-5-
InChIKeyVBADCMNXAPUJCW-YHYXMXQVSA-N
MW250.29 g/mol
LogP2.67
Rot. Bonds5

About methyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate

methyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate (PubChem CID 90051649) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is methyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate.

Molecular Properties

Compound Namemethyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate
PubChem CID90051649
Molecular FormulaC14H18O4
Molecular Weight250.29 g/mol
Exact Mass250.12
IUPAC Namemethyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate
SMILESCOC(=O)C/C=C(/C)c1cc(OC)ccc1OC
InChIInChI=1S/C14H18O4/c1-10(5-8-14(15)18-4)12-9-11(16-2)6-7-13(12)17-3/h5-7,9H,8H2,1-4H3/b10-5-
InChIKeyVBADCMNXAPUJCW-YHYXMXQVSA-N
XLogP2.67
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.29
LogP ≤ 52.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate?
The IUPAC name of methyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate (CID 90051649) is methyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate.
What is the SMILES notation for methyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate?
The canonical SMILES for methyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate is COC(=O)C/C=C(/C)c1cc(OC)ccc1OC.
What is the InChIKey of methyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate?
The InChIKey is VBADCMNXAPUJCW-YHYXMXQVSA-N. The full InChI is InChI=1S/C14H18O4/c1-10(5-8-14(15)18-4)12-9-11(16-2)6-7-13(12)17-3/h5-7,9H,8H2,1-4H3/b10-5-.
What are the key properties of methyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate?
methyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate has a molecular weight of 250.29 g/mol, XLogP of 2.67, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-4-(2,5-dimethoxyphenyl)pent-3-enoate is sourced from PubChem (CID 90051649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).