C13H17ClO3 — CID 146006279
3-chloro-1-(2,4-dimethoxyphenyl)-2,2-dimethylpropan-1-one (PubChem CID 146006279) has the molecular formula C13H17ClO3 and a molecular weight of 256.73 g/mol. Its IUPAC name is 3-chloro-1-(2,4-dimethoxyphenyl)-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-(2,4-dimethoxyphenyl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 146006279 |
| Molecular Formula | C13H17ClO3 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-chloro-1-(2,4-dimethoxyphenyl)-2,2-dimethylpropan-1-one |
| SMILES | COc1ccc(C(=O)C(C)(C)CCl)c(OC)c1 |
| InChI | InChI=1S/C13H17ClO3/c1-13(2,8-14)12(15)10-6-5-9(16-3)7-11(10)17-4/h5-7H,8H2,1-4H3 |
| InChIKey | HYSIUCHOUCTGGM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|