C15H22ClNO3 — CID 106168512
N-(1-chloro-3-methylpentan-3-yl)-2,4-dimethoxybenzamide (PubChem CID 106168512) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is N-(1-chloro-3-methylpentan-3-yl)-2,4-dimethoxybenzamide.
| Compound Name | N-(1-chloro-3-methylpentan-3-yl)-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 106168512 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-(1-chloro-3-methylpentan-3-yl)-2,4-dimethoxybenzamide |
| SMILES | CCC(C)(CCCl)NC(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C15H22ClNO3/c1-5-15(2,8-9-16)17-14(18)12-7-6-11(19-3)10-13(12)20-4/h6-7,10H,5,8-9H2,1-4H3,(H,17,18) |
| InChIKey | PGJHSWJSDVKSLI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|