C14H20BrNO3 — CID 114153212
N-(1-bromo-3-methylpentan-3-yl)-2-hydroxy-3-methoxybenzamide (PubChem CID 114153212) has the molecular formula C14H20BrNO3 and a molecular weight of 330.22 g/mol. Its IUPAC name is N-(1-bromo-3-methylpentan-3-yl)-2-hydroxy-3-methoxybenzamide.
| Compound Name | N-(1-bromo-3-methylpentan-3-yl)-2-hydroxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 114153212 |
| Molecular Formula | C14H20BrNO3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | N-(1-bromo-3-methylpentan-3-yl)-2-hydroxy-3-methoxybenzamide |
| SMILES | CCC(C)(CCBr)NC(=O)c1cccc(OC)c1O |
| InChI | InChI=1S/C14H20BrNO3/c1-4-14(2,8-9-15)16-13(18)10-6-5-7-11(19-3)12(10)17/h5-7,17H,4,8-9H2,1-3H3,(H,16,18) |
| InChIKey | GTDJIRUXYIHCSR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|