C14H19NO6 — CID 27282578
(4S)-4-amino-5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoic acid (PubChem CID 27282578) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is (4S)-4-amino-5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoic acid.
| Compound Name | (4S)-4-amino-5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 27282578 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (4S)-4-amino-5-oxo-5-(2,4,6-trimethoxyphenyl)pentanoic acid |
| SMILES | COc1cc(OC)c(C(=O)[C@@H](N)CCC(=O)O)c(OC)c1 |
| InChI | InChI=1S/C14H19NO6/c1-19-8-6-10(20-2)13(11(7-8)21-3)14(18)9(15)4-5-12(16)17/h6-7,9H,4-5,15H2,1-3H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | SLRIOPUZCHMQNP-VIFPVBQESA-N |
| XLogP | 1.09 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |