C12H20N2O3 — CID 116855607
2-(2,4,6-trimethoxyphenyl)propane-1,2-diamine (PubChem CID 116855607) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-(2,4,6-trimethoxyphenyl)propane-1,2-diamine.
| Compound Name | 2-(2,4,6-trimethoxyphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 116855607 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-(2,4,6-trimethoxyphenyl)propane-1,2-diamine |
| SMILES | COc1cc(OC)c(C(C)(N)CN)c(OC)c1 |
| InChI | InChI=1S/C12H20N2O3/c1-12(14,7-13)11-9(16-3)5-8(15-2)6-10(11)17-4/h5-6H,7,13-14H2,1-4H3 |
| InChIKey | DRCOVXMFZIBQSV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |