C13H25BrNO6P — CID 135262838
2-amino-2-(hydroxymethyl)propane-1,3-diol;2-bromo-1,3,5-trimethoxybenzene;phosphane (PubChem CID 135262838) has the molecular formula C13H25BrNO6P and a molecular weight of 402.22 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-bromo-1,3,5-trimethoxybenzene;phosphane.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-bromo-1,3,5-trimethoxybenzene;phosphane |
|---|---|
| PubChem CID | 135262838 |
| Molecular Formula | C13H25BrNO6P |
| Molecular Weight | 402.22 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-bromo-1,3,5-trimethoxybenzene;phosphane |
| SMILES | COc1cc(OC)c(Br)c(OC)c1.NC(CO)(CO)CO.P |
| InChI | InChI=1S/C9H11BrO3.C4H11NO3.H3P/c1-11-6-4-7(12-2)9(10)8(5-6)13-3;5-4(1-6,2-7)3-8;/h4-5H,1-3H3;6-8H,1-3,5H2;1H3 |
| InChIKey | AZPYOCJZTAFRMS-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.22 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|