C15H22O7 — CID 134248635
2,2-bis(hydroxymethyl)-4-(2,4,6-trimethoxyphenyl)but-3-ene-1,3-diol (PubChem CID 134248635) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)-4-(2,4,6-trimethoxyphenyl)but-3-ene-1,3-diol.
| Compound Name | 2,2-bis(hydroxymethyl)-4-(2,4,6-trimethoxyphenyl)but-3-ene-1,3-diol |
|---|---|
| PubChem CID | 134248635 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2,2-bis(hydroxymethyl)-4-(2,4,6-trimethoxyphenyl)but-3-ene-1,3-diol |
| SMILES | COc1cc(OC)c(C=C(O)C(CO)(CO)CO)c(OC)c1 |
| InChI | InChI=1S/C15H22O7/c1-20-10-4-12(21-2)11(13(5-10)22-3)6-14(19)15(7-16,8-17)9-18/h4-6,16-19H,7-9H2,1-3H3 |
| InChIKey | CLVJGOPTOKBSHK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|