C15H28NO8P — CID 68986056
acetic acid;2-amino-2-(hydroxymethyl)propane-1,3-diol;(2,4,6-trimethoxyphenyl)phosphane (PubChem CID 68986056) has the molecular formula C15H28NO8P and a molecular weight of 381.36 g/mol. Its IUPAC name is acetic acid;2-amino-2-(hydroxymethyl)propane-1,3-diol;(2,4,6-trimethoxyphenyl)phosphane.
| Compound Name | acetic acid;2-amino-2-(hydroxymethyl)propane-1,3-diol;(2,4,6-trimethoxyphenyl)phosphane |
|---|---|
| PubChem CID | 68986056 |
| Molecular Formula | C15H28NO8P |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | acetic acid;2-amino-2-(hydroxymethyl)propane-1,3-diol;(2,4,6-trimethoxyphenyl)phosphane |
| SMILES | CC(=O)O.COc1cc(OC)c(P)c(OC)c1.NC(CO)(CO)CO |
| InChI | InChI=1S/C9H13O3P.C4H11NO3.C2H4O2/c1-10-6-4-7(11-2)9(13)8(5-6)12-3;5-4(1-6,2-7)3-8;1-2(3)4/h4-5H,13H2,1-3H3;6-8H,1-3,5H2;1H3,(H,3,4) |
| InChIKey | SBPHNSPKILHOET-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|