C16H25NO5 — CID 151789333
2-amino-2,4-dimethyl-5-(2,4,6-trimethoxyphenyl)pentanoic acid (PubChem CID 151789333) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-amino-2,4-dimethyl-5-(2,4,6-trimethoxyphenyl)pentanoic acid.
| Compound Name | 2-amino-2,4-dimethyl-5-(2,4,6-trimethoxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 151789333 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2-amino-2,4-dimethyl-5-(2,4,6-trimethoxyphenyl)pentanoic acid |
| SMILES | COc1cc(OC)c(CC(C)CC(C)(N)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C16H25NO5/c1-10(9-16(2,17)15(18)19)6-12-13(21-4)7-11(20-3)8-14(12)22-5/h7-8,10H,6,9,17H2,1-5H3,(H,18,19) |
| InChIKey | RWHBQRDPORCZMG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |