C17H27NO5 — CID 150246943
2-amino-2-methyl-4-[(2,3,4-trimethoxyphenyl)methyl]hexanoic acid (PubChem CID 150246943) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-amino-2-methyl-4-[(2,3,4-trimethoxyphenyl)methyl]hexanoic acid.
| Compound Name | 2-amino-2-methyl-4-[(2,3,4-trimethoxyphenyl)methyl]hexanoic acid |
|---|---|
| PubChem CID | 150246943 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-amino-2-methyl-4-[(2,3,4-trimethoxyphenyl)methyl]hexanoic acid |
| SMILES | CCC(Cc1ccc(OC)c(OC)c1OC)CC(C)(N)C(=O)O |
| InChI | InChI=1S/C17H27NO5/c1-6-11(10-17(2,18)16(19)20)9-12-7-8-13(21-3)15(23-5)14(12)22-4/h7-8,11H,6,9-10,18H2,1-5H3,(H,19,20) |
| InChIKey | FYSDRKRTMZVCND-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |