C16H24O5 — CID 154057350
2-[(2,3,4-trimethoxyphenyl)methyl]hexanoic acid (PubChem CID 154057350) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is 2-[(2,3,4-trimethoxyphenyl)methyl]hexanoic acid.
| Compound Name | 2-[(2,3,4-trimethoxyphenyl)methyl]hexanoic acid |
|---|---|
| PubChem CID | 154057350 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-[(2,3,4-trimethoxyphenyl)methyl]hexanoic acid |
| SMILES | CCCCC(Cc1ccc(OC)c(OC)c1OC)C(=O)O |
| InChI | InChI=1S/C16H24O5/c1-5-6-7-12(16(17)18)10-11-8-9-13(19-2)15(21-4)14(11)20-3/h8-9,12H,5-7,10H2,1-4H3,(H,17,18) |
| InChIKey | ZEAGMMSRWKMABE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |