C13H18O3 — CID 169488668
2-[(2-methoxy-3-methylphenyl)methyl]butanoic acid (PubChem CID 169488668) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-[(2-methoxy-3-methylphenyl)methyl]butanoic acid.
| Compound Name | 2-[(2-methoxy-3-methylphenyl)methyl]butanoic acid |
|---|---|
| PubChem CID | 169488668 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-[(2-methoxy-3-methylphenyl)methyl]butanoic acid |
| SMILES | CCC(Cc1cccc(C)c1OC)C(=O)O |
| InChI | InChI=1S/C13H18O3/c1-4-10(13(14)15)8-11-7-5-6-9(2)12(11)16-3/h5-7,10H,4,8H2,1-3H3,(H,14,15) |
| InChIKey | RMJOQIAJHUSPBP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |