2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid

C12H16O5S — CID 24754535

IUPAC2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid
SMILESCOc1ccc(CSCC(=O)O)c(OC)c1OC
InChIInChI=1S/C12H16O5S/c1-15-9-5-4-8(6-18-7-10(13)14)11(16-2)12(9)17-3/h4-5H,6-7H2,1-3H3,(H,13,14)
InChIKeyAQLSPZSWZJHFHS-UHFFFAOYSA-N
MW272.32 g/mol
LogP2.03
Rot. Bonds7

About 2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid

2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid (PubChem CID 24754535) has the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. Its IUPAC name is 2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid.

Molecular Properties

Compound Name2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid
PubChem CID24754535
Molecular FormulaC12H16O5S
Molecular Weight272.32 g/mol
Exact Mass272.07
IUPAC Name2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid
SMILESCOc1ccc(CSCC(=O)O)c(OC)c1OC
InChIInChI=1S/C12H16O5S/c1-15-9-5-4-8(6-18-7-10(13)14)11(16-2)12(9)17-3/h4-5H,6-7H2,1-3H3,(H,13,14)
InChIKeyAQLSPZSWZJHFHS-UHFFFAOYSA-N
XLogP2.03
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.32
LogP ≤ 52.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid?
The IUPAC name of 2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid (CID 24754535) is 2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid.
What is the SMILES notation for 2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid?
The canonical SMILES for 2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid is COc1ccc(CSCC(=O)O)c(OC)c1OC.
What is the InChIKey of 2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid?
The InChIKey is AQLSPZSWZJHFHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O5S/c1-15-9-5-4-8(6-18-7-10(13)14)11(16-2)12(9)17-3/h4-5H,6-7H2,1-3H3,(H,13,14).
What are the key properties of 2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid?
2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid has a molecular weight of 272.32 g/mol, XLogP of 2.03, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3,4-trimethoxyphenyl)methylsulfanyl]acetic acid is sourced from PubChem (CID 24754535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).