C9H9F3O3S — CID 170909713
3,5-dimethoxy-2-(trifluoromethylsulfanyl)phenol (PubChem CID 170909713) has the molecular formula C9H9F3O3S and a molecular weight of 254.23 g/mol. Its IUPAC name is 3,5-dimethoxy-2-(trifluoromethylsulfanyl)phenol.
| Compound Name | 3,5-dimethoxy-2-(trifluoromethylsulfanyl)phenol |
|---|---|
| PubChem CID | 170909713 |
| Molecular Formula | C9H9F3O3S |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 3,5-dimethoxy-2-(trifluoromethylsulfanyl)phenol |
| SMILES | COc1cc(O)c(SC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C9H9F3O3S/c1-14-5-3-6(13)8(7(4-5)15-2)16-9(10,11)12/h3-4,13H,1-2H3 |
| InChIKey | SYUQFABNBQWUNO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |