C14H14O3S — CID 11471007
3,5-dimethoxy-2-phenylsulfanylphenol (PubChem CID 11471007) has the molecular formula C14H14O3S and a molecular weight of 262.33 g/mol. Its IUPAC name is 3,5-dimethoxy-2-phenylsulfanylphenol.
| Compound Name | 3,5-dimethoxy-2-phenylsulfanylphenol |
|---|---|
| PubChem CID | 11471007 |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 3,5-dimethoxy-2-phenylsulfanylphenol |
| SMILES | COc1cc(O)c(Sc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C14H14O3S/c1-16-10-8-12(15)14(13(9-10)17-2)18-11-6-4-3-5-7-11/h3-9,15H,1-2H3 |
| InChIKey | CGLUBTYJJIMEKF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |