C21H20O3S2 — CID 138976814
1,3,5-trimethoxy-2,4-bis(phenylsulfanyl)benzene (PubChem CID 138976814) has the molecular formula C21H20O3S2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1,3,5-trimethoxy-2,4-bis(phenylsulfanyl)benzene.
| Compound Name | 1,3,5-trimethoxy-2,4-bis(phenylsulfanyl)benzene |
|---|---|
| PubChem CID | 138976814 |
| Molecular Formula | C21H20O3S2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1,3,5-trimethoxy-2,4-bis(phenylsulfanyl)benzene |
| SMILES | COc1cc(OC)c(Sc2ccccc2)c(OC)c1Sc1ccccc1 |
| InChI | InChI=1S/C21H20O3S2/c1-22-17-14-18(23-2)21(26-16-12-8-5-9-13-16)19(24-3)20(17)25-15-10-6-4-7-11-15/h4-14H,1-3H3 |
| InChIKey | XEMXGGLNPSWKDM-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |