C14H13ClO2S — CID 132568881
2-(3-chlorophenyl)sulfanyl-1,3-dimethoxybenzene (PubChem CID 132568881) has the molecular formula C14H13ClO2S and a molecular weight of 280.78 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfanyl-1,3-dimethoxybenzene.
| Compound Name | 2-(3-chlorophenyl)sulfanyl-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 132568881 |
| Molecular Formula | C14H13ClO2S |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-(3-chlorophenyl)sulfanyl-1,3-dimethoxybenzene |
| SMILES | COc1cccc(OC)c1Sc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H13ClO2S/c1-16-12-7-4-8-13(17-2)14(12)18-11-6-3-5-10(15)9-11/h3-9H,1-2H3 |
| InChIKey | DBXFMDXXVQDXEI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |