C16H17Cl2NOS — CID 66145992
1-(5-chloro-2-methoxyphenyl)-3-(3-chlorophenyl)sulfanylpropan-2-amine (PubChem CID 66145992) has the molecular formula C16H17Cl2NOS and a molecular weight of 342.29 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-(3-chlorophenyl)sulfanylpropan-2-amine.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-(3-chlorophenyl)sulfanylpropan-2-amine |
|---|---|
| PubChem CID | 66145992 |
| Molecular Formula | C16H17Cl2NOS |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-(3-chlorophenyl)sulfanylpropan-2-amine |
| SMILES | COc1ccc(Cl)cc1CC(N)CSc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17Cl2NOS/c1-20-16-6-5-13(18)7-11(16)8-14(19)10-21-15-4-2-3-12(17)9-15/h2-7,9,14H,8,10,19H2,1H3 |
| InChIKey | XSANRVUINOTTDA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |