About 3-((3-Chlorophenyl) thio)benzo[b] thiophen-2-amine hydrochloride
3-((3-Chlorophenyl) thio)benzo[b] thiophen-2-amine hydrochloride (PubChem CID 140841358) has the molecular formula C14H9ClNS2
and a molecular weight of 290.82 g/mol.
Molecular Properties
| Compound Name | 3-((3-Chlorophenyl) thio)benzo[b] thiophen-2-amine hydrochloride |
| PubChem CID | 140841358 |
| Molecular Formula | C14H9ClNS2 |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | — |
| SMILES | [NH]c1sc2ccccc2c1Sc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H9ClNS2/c15-9-4-3-5-10(8-9)17-13-11-6-1-2-7-12(11)18-14(13)16/h1-8,16H |
| InChIKey | CKHKHBSJSOGXET-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-((3-Chlorophenyl) thio)benzo[b] thiophen-2-amine hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-((3-Chlorophenyl) thio)benzo[b] thiophen-2-amine hydrochloride?
The IUPAC name of 3-((3-Chlorophenyl) thio)benzo[b] thiophen-2-amine hydrochloride (CID 140841358) is not available.
What is the SMILES notation for 3-((3-Chlorophenyl) thio)benzo[b] thiophen-2-amine hydrochloride?
The canonical SMILES for 3-((3-Chlorophenyl) thio)benzo[b] thiophen-2-amine hydrochloride is [NH]c1sc2ccccc2c1Sc1cccc(Cl)c1.
What is the InChIKey of 3-((3-Chlorophenyl) thio)benzo[b] thiophen-2-amine hydrochloride?
The InChIKey is CKHKHBSJSOGXET-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClNS2/c15-9-4-3-5-10(8-9)17-13-11-6-1-2-7-12(11)18-14(13)16/h1-8,16H.
What are the key properties of 3-((3-Chlorophenyl) thio)benzo[b] thiophen-2-amine hydrochloride?
3-((3-Chlorophenyl) thio)benzo[b] thiophen-2-amine hydrochloride has a molecular weight of 290.82 g/mol, XLogP of 5.62, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-((3-Chlorophenyl) thio)benzo[b] thiophen-2-amine hydrochloride is sourced from PubChem (CID 140841358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).